C24H30Cl4N6O2 — CID 23730383
(2S)-2-amino-5-(diaminomethylideneamino)-N-[2-(2,4-dichlorophenyl)ethyl]-N-[2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl]pentanamide (PubChem CID 23730383) has the molecular formula C24H30Cl4N6O2 and a molecular weight of 576.36 g/mol. Its IUPAC name is (2S)-2-amino-5-(diaminomethylideneamino)-N-[2-(2,4-dichlorophenyl)ethyl]-N-[2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl]pentanamide.
| Compound Name | (2S)-2-amino-5-(diaminomethylideneamino)-N-[2-(2,4-dichlorophenyl)ethyl]-N-[2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl]pentanamide |
|---|---|
| PubChem CID | 23730383 |
| Molecular Formula | C24H30Cl4N6O2 |
| Molecular Weight | 576.36 g/mol |
| Exact Mass | 574.12 |
| IUPAC Name | (2S)-2-amino-5-(diaminomethylideneamino)-N-[2-(2,4-dichlorophenyl)ethyl]-N-[2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl]pentanamide |
| SMILES | NC(N)=NCCC[C@H](N)C(=O)N(CCc1ccc(Cl)cc1Cl)CC(=O)NCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H30Cl4N6O2/c25-17-5-3-15(19(27)12-17)7-10-32-22(35)14-34(11-8-16-4-6-18(26)13-20(16)28)23(36)21(29)2-1-9-33-24(30)31/h3-6,12-13,21H,1-2,7-11,14,29H2,(H,32,35)(H4,30,31,33)/t21-/m0/s1 |
| InChIKey | TYIVCKPBPCBXRJ-NRFANRHFSA-N |
| XLogP | 3.41 |
| TPSA | 139.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|