C25H23N3O2 — CID 23730398
4,5-dimethyl-N,12-diphenyl-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carboxamide (PubChem CID 23730398) has the molecular formula C25H23N3O2 and a molecular weight of 397.48 g/mol. Its IUPAC name is 4,5-dimethyl-N,12-diphenyl-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carboxamide.
| Compound Name | 4,5-dimethyl-N,12-diphenyl-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 23730398 |
| Molecular Formula | C25H23N3O2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 4,5-dimethyl-N,12-diphenyl-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carboxamide |
| SMILES | Cc1nc2c3c(c(C(=O)Nc4ccccc4)cn2c1C)CCC(c1ccccc1)O3 |
| InChI | InChI=1S/C25H23N3O2/c1-16-17(2)28-15-21(25(29)27-19-11-7-4-8-12-19)20-13-14-22(18-9-5-3-6-10-18)30-23(20)24(28)26-16/h3-12,15,22H,13-14H2,1-2H3,(H,27,29) |
| InChIKey | IHKXLAGGBFNSGG-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |