C21H21N3O2 — CID 23730401
8-(4,5-dihydro-1,3-oxazol-2-yl)-4,5-dimethyl-12-phenyl-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene (PubChem CID 23730401) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is 8-(4,5-dihydro-1,3-oxazol-2-yl)-4,5-dimethyl-12-phenyl-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene.
| Compound Name | 8-(4,5-dihydro-1,3-oxazol-2-yl)-4,5-dimethyl-12-phenyl-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene |
|---|---|
| PubChem CID | 23730401 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 8-(4,5-dihydro-1,3-oxazol-2-yl)-4,5-dimethyl-12-phenyl-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene |
| SMILES | Cc1nc2c3c(c(C4=NCCO4)cn2c1C)CCC(c1ccccc1)O3 |
| InChI | InChI=1S/C21H21N3O2/c1-13-14(2)24-12-17(21-22-10-11-25-21)16-8-9-18(15-6-4-3-5-7-15)26-19(16)20(24)23-13/h3-7,12,18H,8-11H2,1-2H3 |
| InChIKey | FHUKUZLISTZZHW-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 48.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |