C35H30ClNO7S — CID 23730515
[4-(4-chlorophenyl)-3-[(2,2-dimethyl-3,4-dihydrochromene-6-carbonyl)amino]-8-methyl-2-oxochromen-7-yl] 4-methylbenzenesulfonate (PubChem CID 23730515) has the molecular formula C35H30ClNO7S and a molecular weight of 644.15 g/mol. Its IUPAC name is [4-(4-chlorophenyl)-3-[(2,2-dimethyl-3,4-dihydrochromene-6-carbonyl)amino]-8-methyl-2-oxochromen-7-yl] 4-methylbenzenesulfonate.
| Compound Name | [4-(4-chlorophenyl)-3-[(2,2-dimethyl-3,4-dihydrochromene-6-carbonyl)amino]-8-methyl-2-oxochromen-7-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 23730515 |
| Molecular Formula | C35H30ClNO7S |
| Molecular Weight | 644.15 g/mol |
| Exact Mass | 643.14 |
| IUPAC Name | [4-(4-chlorophenyl)-3-[(2,2-dimethyl-3,4-dihydrochromene-6-carbonyl)amino]-8-methyl-2-oxochromen-7-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc3c(-c4ccc(Cl)cc4)c(NC(=O)c4ccc5c(c4)CCC(C)(C)O5)c(=O)oc3c2C)cc1 |
| InChI | InChI=1S/C35H30ClNO7S/c1-20-5-12-26(13-6-20)45(40,41)44-28-16-14-27-30(22-7-10-25(36)11-8-22)31(34(39)42-32(27)21(28)2)37-33(38)24-9-15-29-23(19-24)17-18-35(3,4)43-29/h5-16,19H,17-18H2,1-4H3,(H,37,38) |
| InChIKey | ZFDPXTQVDFPWHY-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.15 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|