About 4-chloro-5-(3,5-dimethylphenyl)-2,6-dimethoxypyrimidine
4-chloro-5-(3,5-dimethylphenyl)-2,6-dimethoxypyrimidine (PubChem CID 23730594) has the molecular formula C14H15ClN2O2
and a molecular weight of 278.74 g/mol. Its IUPAC name is 4-chloro-5-(3,5-dimethylphenyl)-2,6-dimethoxypyrimidine.
Molecular Properties
| Compound Name | 4-chloro-5-(3,5-dimethylphenyl)-2,6-dimethoxypyrimidine |
| PubChem CID | 23730594 |
| Molecular Formula | C14H15ClN2O2 |
| Molecular Weight | 278.74 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 4-chloro-5-(3,5-dimethylphenyl)-2,6-dimethoxypyrimidine |
| SMILES | COc1nc(Cl)c(-c2cc(C)cc(C)c2)c(OC)n1 |
| InChI | InChI=1S/C14H15ClN2O2/c1-8-5-9(2)7-10(6-8)11-12(15)16-14(19-4)17-13(11)18-3/h5-7H,1-4H3 |
| InChIKey | ATANHQNVSQMXJT-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.74 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-chloro-5-(3,5-dimethylphenyl)-2,6-dimethoxypyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-5-(3,5-dimethylphenyl)-2,6-dimethoxypyrimidine?
The IUPAC name of 4-chloro-5-(3,5-dimethylphenyl)-2,6-dimethoxypyrimidine (CID 23730594) is 4-chloro-5-(3,5-dimethylphenyl)-2,6-dimethoxypyrimidine.
What is the SMILES notation for 4-chloro-5-(3,5-dimethylphenyl)-2,6-dimethoxypyrimidine?
The canonical SMILES for 4-chloro-5-(3,5-dimethylphenyl)-2,6-dimethoxypyrimidine is COc1nc(Cl)c(-c2cc(C)cc(C)c2)c(OC)n1.
What is the InChIKey of 4-chloro-5-(3,5-dimethylphenyl)-2,6-dimethoxypyrimidine?
The InChIKey is ATANHQNVSQMXJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15ClN2O2/c1-8-5-9(2)7-10(6-8)11-12(15)16-14(19-4)17-13(11)18-3/h5-7H,1-4H3.
What are the key properties of 4-chloro-5-(3,5-dimethylphenyl)-2,6-dimethoxypyrimidine?
4-chloro-5-(3,5-dimethylphenyl)-2,6-dimethoxypyrimidine has a molecular weight of 278.74 g/mol, XLogP of 3.43, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-5-(3,5-dimethylphenyl)-2,6-dimethoxypyrimidine is sourced from PubChem (CID 23730594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).