C16H22N4O2 — CID 23730600
(2S)-2-(2-aminoethylamino)-3-[1-(2-phenylethyl)imidazol-4-yl]propanoic acid (PubChem CID 23730600) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is (2S)-2-(2-aminoethylamino)-3-[1-(2-phenylethyl)imidazol-4-yl]propanoic acid.
| Compound Name | (2S)-2-(2-aminoethylamino)-3-[1-(2-phenylethyl)imidazol-4-yl]propanoic acid |
|---|---|
| PubChem CID | 23730600 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | (2S)-2-(2-aminoethylamino)-3-[1-(2-phenylethyl)imidazol-4-yl]propanoic acid |
| SMILES | NCCN[C@@H](Cc1cn(CCc2ccccc2)cn1)C(=O)O |
| InChI | InChI=1S/C16H22N4O2/c17-7-8-18-15(16(21)22)10-14-11-20(12-19-14)9-6-13-4-2-1-3-5-13/h1-5,11-12,15,18H,6-10,17H2,(H,21,22)/t15-/m0/s1 |
| InChIKey | KIBISFXBVFKORC-HNNXBMFYSA-N |
| XLogP | 0.67 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |