About (1S,7R)-1,7-dimethoxy-10-oxabicyclo[5.2.1]decan-4-one
(1S,7R)-1,7-dimethoxy-10-oxabicyclo[5.2.1]decan-4-one (PubChem CID 23730769) has the molecular formula C11H18O4
and a molecular weight of 214.26 g/mol. Its IUPAC name is (1S,7R)-1,7-dimethoxy-10-oxabicyclo[5.2.1]decan-4-one.
Molecular Properties
| Compound Name | (1S,7R)-1,7-dimethoxy-10-oxabicyclo[5.2.1]decan-4-one |
| PubChem CID | 23730769 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | (1S,7R)-1,7-dimethoxy-10-oxabicyclo[5.2.1]decan-4-one |
| SMILES | CO[C@]12CCC(=O)CC[C@](OC)(CC1)O2 |
| InChI | InChI=1S/C11H18O4/c1-13-10-5-3-9(12)4-6-11(14-2,15-10)8-7-10/h3-8H2,1-2H3/t10-,11+ |
| InChIKey | ISJACLQQPMBTAL-PHIMTYICSA-N |
| XLogP | 1.63 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1S,7R)-1,7-dimethoxy-10-oxabicyclo[5.2.1]decan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,7R)-1,7-dimethoxy-10-oxabicyclo[5.2.1]decan-4-one?
The IUPAC name of (1S,7R)-1,7-dimethoxy-10-oxabicyclo[5.2.1]decan-4-one (CID 23730769) is (1S,7R)-1,7-dimethoxy-10-oxabicyclo[5.2.1]decan-4-one.
What is the SMILES notation for (1S,7R)-1,7-dimethoxy-10-oxabicyclo[5.2.1]decan-4-one?
The canonical SMILES for (1S,7R)-1,7-dimethoxy-10-oxabicyclo[5.2.1]decan-4-one is CO[C@]12CCC(=O)CC[C@](OC)(CC1)O2.
What is the InChIKey of (1S,7R)-1,7-dimethoxy-10-oxabicyclo[5.2.1]decan-4-one?
The InChIKey is ISJACLQQPMBTAL-PHIMTYICSA-N. The full InChI is InChI=1S/C11H18O4/c1-13-10-5-3-9(12)4-6-11(14-2,15-10)8-7-10/h3-8H2,1-2H3/t10-,11+.
What are the key properties of (1S,7R)-1,7-dimethoxy-10-oxabicyclo[5.2.1]decan-4-one?
(1S,7R)-1,7-dimethoxy-10-oxabicyclo[5.2.1]decan-4-one has a molecular weight of 214.26 g/mol, XLogP of 1.63, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,7R)-1,7-dimethoxy-10-oxabicyclo[5.2.1]decan-4-one is sourced from PubChem (CID 23730769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).