C16H15F5O2 — CID 23730914
cis-(2,3,4,5,6-pentafluorophenyl)methyl (1R,3R)-2,2-dimethyl-3-[(Z)-prop-1-enyl]cyclopropane-1-carboxylate (PubChem CID 23730914) has the molecular formula C16H15F5O2 and a molecular weight of 334.28 g/mol. Its IUPAC name is cis-(2,3,4,5,6-pentafluorophenyl)methyl (1R,3R)-2,2-dimethyl-3-[(Z)-prop-1-enyl]cyclopropane-1-carboxylate.
| Compound Name | cis-(2,3,4,5,6-pentafluorophenyl)methyl (1R,3R)-2,2-dimethyl-3-[(Z)-prop-1-enyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 23730914 |
| Molecular Formula | C16H15F5O2 |
| Molecular Weight | 334.28 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | cis-(2,3,4,5,6-pentafluorophenyl)methyl (1R,3R)-2,2-dimethyl-3-[(Z)-prop-1-enyl]cyclopropane-1-carboxylate |
| SMILES | C/C=C\[C@@H]1[C@@H](C(=O)OCc2c(F)c(F)c(F)c(F)c2F)C1(C)C |
| InChI | InChI=1S/C16H15F5O2/c1-4-5-8-9(16(8,2)3)15(22)23-6-7-10(17)12(19)14(21)13(20)11(7)18/h4-5,8-9H,6H2,1-3H3/b5-4-/t8-,9+/m1/s1 |
| InChIKey | PSMLPNDDTSWGAD-KHTCFXRASA-N |
| XLogP | 4.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.28 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|