C16H30O4Si — CID 23731174
(5R,7R,8aR)-5-[tert-butyl(dimethyl)silyl]oxy-7-(hydroxymethyl)-2,3,5,6,8,8a-hexahydrochromen-7-ol (PubChem CID 23731174) has the molecular formula C16H30O4Si and a molecular weight of 314.50 g/mol. Its IUPAC name is (5R,7R,8aR)-5-[tert-butyl(dimethyl)silyl]oxy-7-(hydroxymethyl)-2,3,5,6,8,8a-hexahydrochromen-7-ol.
| Compound Name | (5R,7R,8aR)-5-[tert-butyl(dimethyl)silyl]oxy-7-(hydroxymethyl)-2,3,5,6,8,8a-hexahydrochromen-7-ol |
|---|---|
| PubChem CID | 23731174 |
| Molecular Formula | C16H30O4Si |
| Molecular Weight | 314.50 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | (5R,7R,8aR)-5-[tert-butyl(dimethyl)silyl]oxy-7-(hydroxymethyl)-2,3,5,6,8,8a-hexahydrochromen-7-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@@](O)(CO)C[C@H]2OCCC=C21 |
| InChI | InChI=1S/C16H30O4Si/c1-15(2,3)21(4,5)20-14-10-16(18,11-17)9-13-12(14)7-6-8-19-13/h7,13-14,17-18H,6,8-11H2,1-5H3/t13-,14-,16-/m1/s1 |
| InChIKey | TVWWVWDXJOTQOM-IIAWOOMASA-N |
| XLogP | 2.61 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.50 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|