C18H18N2O — CID 23731186
4,5-dimethyl-12-phenyl-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene (PubChem CID 23731186) has the molecular formula C18H18N2O and a molecular weight of 278.36 g/mol. Its IUPAC name is 4,5-dimethyl-12-phenyl-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene.
| Compound Name | 4,5-dimethyl-12-phenyl-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene |
|---|---|
| PubChem CID | 23731186 |
| Molecular Formula | C18H18N2O |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 4,5-dimethyl-12-phenyl-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene |
| SMILES | Cc1nc2c3c(ccn2c1C)CCC(c1ccccc1)O3 |
| InChI | InChI=1S/C18H18N2O/c1-12-13(2)20-11-10-15-8-9-16(14-6-4-3-5-7-14)21-17(15)18(20)19-12/h3-7,10-11,16H,8-9H2,1-2H3 |
| InChIKey | AFCHDIUKBZSOPK-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |