C25H25N3O5 — CID 23731311
(1R,2S,6R,7S)-11-(cyclopropylmethyl)-1-methyl-7-(5-methylfuran-2-yl)-4-phenyl-4,8,11-triazatricyclo[6.4.0.02,6]dodecane-3,5,9,12-tetrone (PubChem CID 23731311) has the molecular formula C25H25N3O5 and a molecular weight of 447.49 g/mol. Its IUPAC name is (1R,2S,6R,7S)-11-(cyclopropylmethyl)-1-methyl-7-(5-methylfuran-2-yl)-4-phenyl-4,8,11-triazatricyclo[6.4.0.02,6]dodecane-3,5,9,12-tetrone.
| Compound Name | (1R,2S,6R,7S)-11-(cyclopropylmethyl)-1-methyl-7-(5-methylfuran-2-yl)-4-phenyl-4,8,11-triazatricyclo[6.4.0.02,6]dodecane-3,5,9,12-tetrone |
|---|---|
| PubChem CID | 23731311 |
| Molecular Formula | C25H25N3O5 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | (1R,2S,6R,7S)-11-(cyclopropylmethyl)-1-methyl-7-(5-methylfuran-2-yl)-4-phenyl-4,8,11-triazatricyclo[6.4.0.02,6]dodecane-3,5,9,12-tetrone |
| SMILES | Cc1ccc([C@@H]2[C@@H]3C(=O)N(c4ccccc4)C(=O)[C@@H]3[C@]3(C)C(=O)N(CC4CC4)CC(=O)N23)o1 |
| InChI | InChI=1S/C25H25N3O5/c1-14-8-11-17(33-14)21-19-20(23(31)27(22(19)30)16-6-4-3-5-7-16)25(2)24(32)26(12-15-9-10-15)13-18(29)28(21)25/h3-8,11,15,19-21H,9-10,12-13H2,1-2H3/t19-,20-,21-,25-/m1/s1 |
| InChIKey | XLAYURVLMUAVEC-QTDDQOEGSA-N |
| XLogP | 2.29 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|