About ethyl 1-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)piperidine-4-carboxylate
ethyl 1-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)piperidine-4-carboxylate (PubChem CID 2373135) has the molecular formula C17H21NO5
and a molecular weight of 319.36 g/mol. Its IUPAC name is ethyl 1-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)piperidine-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)piperidine-4-carboxylate |
| PubChem CID | 2373135 |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | ethyl 1-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)c2ccc3c(c2)OCCO3)CC1 |
| InChI | InChI=1S/C17H21NO5/c1-2-21-17(20)12-5-7-18(8-6-12)16(19)13-3-4-14-15(11-13)23-10-9-22-14/h3-4,11-12H,2,5-10H2,1H3 |
| InChIKey | YAZJEOXKTLONOT-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 1-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)piperidine-4-carboxylate?
The IUPAC name of ethyl 1-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)piperidine-4-carboxylate (CID 2373135) is ethyl 1-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)piperidine-4-carboxylate.
What is the SMILES notation for ethyl 1-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)piperidine-4-carboxylate?
The canonical SMILES for ethyl 1-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)piperidine-4-carboxylate is CCOC(=O)C1CCN(C(=O)c2ccc3c(c2)OCCO3)CC1.
What is the InChIKey of ethyl 1-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)piperidine-4-carboxylate?
The InChIKey is YAZJEOXKTLONOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21NO5/c1-2-21-17(20)12-5-7-18(8-6-12)16(19)13-3-4-14-15(11-13)23-10-9-22-14/h3-4,11-12H,2,5-10H2,1H3.
What are the key properties of ethyl 1-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)piperidine-4-carboxylate?
ethyl 1-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)piperidine-4-carboxylate has a molecular weight of 319.36 g/mol, XLogP of 1.87, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)piperidine-4-carboxylate is sourced from PubChem (CID 2373135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).