C31H29N3O5 — CID 23731354
(1R,2S,6R,7S)-1-benzyl-11-(cyclopropylmethyl)-7-(5-methylfuran-2-yl)-4-phenyl-4,8,11-triazatricyclo[6.4.0.02,6]dodecane-3,5,9,12-tetrone (PubChem CID 23731354) has the molecular formula C31H29N3O5 and a molecular weight of 523.59 g/mol. Its IUPAC name is (1R,2S,6R,7S)-1-benzyl-11-(cyclopropylmethyl)-7-(5-methylfuran-2-yl)-4-phenyl-4,8,11-triazatricyclo[6.4.0.02,6]dodecane-3,5,9,12-tetrone.
| Compound Name | (1R,2S,6R,7S)-1-benzyl-11-(cyclopropylmethyl)-7-(5-methylfuran-2-yl)-4-phenyl-4,8,11-triazatricyclo[6.4.0.02,6]dodecane-3,5,9,12-tetrone |
|---|---|
| PubChem CID | 23731354 |
| Molecular Formula | C31H29N3O5 |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 523.21 |
| IUPAC Name | (1R,2S,6R,7S)-1-benzyl-11-(cyclopropylmethyl)-7-(5-methylfuran-2-yl)-4-phenyl-4,8,11-triazatricyclo[6.4.0.02,6]dodecane-3,5,9,12-tetrone |
| SMILES | Cc1ccc([C@@H]2[C@@H]3C(=O)N(c4ccccc4)C(=O)[C@@H]3[C@]3(Cc4ccccc4)C(=O)N(CC4CC4)CC(=O)N23)o1 |
| InChI | InChI=1S/C31H29N3O5/c1-19-12-15-23(39-19)27-25-26(29(37)33(28(25)36)22-10-6-3-7-11-22)31(16-20-8-4-2-5-9-20)30(38)32(17-21-13-14-21)18-24(35)34(27)31/h2-12,15,21,25-27H,13-14,16-18H2,1H3/t25-,26-,27-,31-/m1/s1 |
| InChIKey | LDZNBZMENBZAEF-ACXCVDCASA-N |
| XLogP | 3.51 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|