C22H27N3O6 — CID 23731359
(1R,2S,6R,7S)-4-ethyl-11-(2-methoxyethyl)-7-(4-methoxyphenyl)-1-methyl-4,8,11-triazatricyclo[6.4.0.02,6]dodecane-3,5,9,12-tetrone (PubChem CID 23731359) has the molecular formula C22H27N3O6 and a molecular weight of 429.47 g/mol. Its IUPAC name is (1R,2S,6R,7S)-4-ethyl-11-(2-methoxyethyl)-7-(4-methoxyphenyl)-1-methyl-4,8,11-triazatricyclo[6.4.0.02,6]dodecane-3,5,9,12-tetrone.
| Compound Name | (1R,2S,6R,7S)-4-ethyl-11-(2-methoxyethyl)-7-(4-methoxyphenyl)-1-methyl-4,8,11-triazatricyclo[6.4.0.02,6]dodecane-3,5,9,12-tetrone |
|---|---|
| PubChem CID | 23731359 |
| Molecular Formula | C22H27N3O6 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | (1R,2S,6R,7S)-4-ethyl-11-(2-methoxyethyl)-7-(4-methoxyphenyl)-1-methyl-4,8,11-triazatricyclo[6.4.0.02,6]dodecane-3,5,9,12-tetrone |
| SMILES | CCN1C(=O)[C@H]2[C@@H](c3ccc(OC)cc3)N3C(=O)CN(CCOC)C(=O)[C@@]3(C)[C@H]2C1=O |
| InChI | InChI=1S/C22H27N3O6/c1-5-24-19(27)16-17(20(24)28)22(2)21(29)23(10-11-30-3)12-15(26)25(22)18(16)13-6-8-14(31-4)9-7-13/h6-9,16-18H,5,10-12H2,1-4H3/t16-,17-,18-,22-/m1/s1 |
| InChIKey | NQYPISDMCQLZSS-OZQHCQBDSA-N |
| XLogP | 0.45 |
| TPSA | 96.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|