C29H33N3O5 — CID 23731361
(1R,2S,6R,7S)-1-benzyl-11-butyl-4-ethyl-7-(4-methoxyphenyl)-4,8,11-triazatricyclo[6.4.0.02,6]dodecane-3,5,9,12-tetrone (PubChem CID 23731361) has the molecular formula C29H33N3O5 and a molecular weight of 503.60 g/mol. Its IUPAC name is (1R,2S,6R,7S)-1-benzyl-11-butyl-4-ethyl-7-(4-methoxyphenyl)-4,8,11-triazatricyclo[6.4.0.02,6]dodecane-3,5,9,12-tetrone.
| Compound Name | (1R,2S,6R,7S)-1-benzyl-11-butyl-4-ethyl-7-(4-methoxyphenyl)-4,8,11-triazatricyclo[6.4.0.02,6]dodecane-3,5,9,12-tetrone |
|---|---|
| PubChem CID | 23731361 |
| Molecular Formula | C29H33N3O5 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | (1R,2S,6R,7S)-1-benzyl-11-butyl-4-ethyl-7-(4-methoxyphenyl)-4,8,11-triazatricyclo[6.4.0.02,6]dodecane-3,5,9,12-tetrone |
| SMILES | CCCCN1CC(=O)N2[C@H](c3ccc(OC)cc3)[C@@H]3C(=O)N(CC)C(=O)[C@@H]3[C@]2(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C29H33N3O5/c1-4-6-16-30-18-22(33)32-25(20-12-14-21(37-3)15-13-20)23-24(27(35)31(5-2)26(23)34)29(32,28(30)36)17-19-10-8-7-9-11-19/h7-15,23-25H,4-6,16-18H2,1-3H3/t23-,24-,25-,29-/m1/s1 |
| InChIKey | FMKFVWDWQSYDFG-DOUCHOMGSA-N |
| XLogP | 2.82 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|