C28H31N3O6 — CID 23731365
(1R,2S,6R,7S)-1-benzyl-4-ethyl-11-(2-methoxyethyl)-7-(4-methoxyphenyl)-4,8,11-triazatricyclo[6.4.0.02,6]dodecane-3,5,9,12-tetrone (PubChem CID 23731365) has the molecular formula C28H31N3O6 and a molecular weight of 505.57 g/mol. Its IUPAC name is (1R,2S,6R,7S)-1-benzyl-4-ethyl-11-(2-methoxyethyl)-7-(4-methoxyphenyl)-4,8,11-triazatricyclo[6.4.0.02,6]dodecane-3,5,9,12-tetrone.
| Compound Name | (1R,2S,6R,7S)-1-benzyl-4-ethyl-11-(2-methoxyethyl)-7-(4-methoxyphenyl)-4,8,11-triazatricyclo[6.4.0.02,6]dodecane-3,5,9,12-tetrone |
|---|---|
| PubChem CID | 23731365 |
| Molecular Formula | C28H31N3O6 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | (1R,2S,6R,7S)-1-benzyl-4-ethyl-11-(2-methoxyethyl)-7-(4-methoxyphenyl)-4,8,11-triazatricyclo[6.4.0.02,6]dodecane-3,5,9,12-tetrone |
| SMILES | CCN1C(=O)[C@H]2[C@@H](c3ccc(OC)cc3)N3C(=O)CN(CCOC)C(=O)[C@@]3(Cc3ccccc3)[C@H]2C1=O |
| InChI | InChI=1S/C28H31N3O6/c1-4-30-25(33)22-23(26(30)34)28(16-18-8-6-5-7-9-18)27(35)29(14-15-36-2)17-21(32)31(28)24(22)19-10-12-20(37-3)13-11-19/h5-13,22-24H,4,14-17H2,1-3H3/t22-,23-,24-,28-/m1/s1 |
| InChIKey | VSROKADBNJGWBK-CBUXHAPBSA-N |
| XLogP | 1.67 |
| TPSA | 96.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|