C19H23Br2NO — CID 23731486
1-(5,7-dibromo-1,2,3,4-tetrahydroxanthen-4a-yl)azepane (PubChem CID 23731486) has the molecular formula C19H23Br2NO and a molecular weight of 441.21 g/mol. Its IUPAC name is 1-(5,7-dibromo-1,2,3,4-tetrahydroxanthen-4a-yl)azepane.
| Compound Name | 1-(5,7-dibromo-1,2,3,4-tetrahydroxanthen-4a-yl)azepane |
|---|---|
| PubChem CID | 23731486 |
| Molecular Formula | C19H23Br2NO |
| Molecular Weight | 441.21 g/mol |
| Exact Mass | 439.01 |
| IUPAC Name | 1-(5,7-dibromo-1,2,3,4-tetrahydroxanthen-4a-yl)azepane |
| SMILES | Brc1cc(Br)c2c(c1)C=C1CCCCC1(N1CCCCCC1)O2 |
| InChI | InChI=1S/C19H23Br2NO/c20-16-12-14-11-15-7-3-4-8-19(15,23-18(14)17(21)13-16)22-9-5-1-2-6-10-22/h11-13H,1-10H2 |
| InChIKey | NWSGPJUOTFASMG-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.21 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |