About N-[1-(4-fluorophenyl)-2-methylpropan-2-yl]-1,2-oxazole-5-carboxamide
N-[1-(4-fluorophenyl)-2-methylpropan-2-yl]-1,2-oxazole-5-carboxamide (PubChem CID 23732491) has the molecular formula C14H15FN2O2
and a molecular weight of 262.28 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)-2-methylpropan-2-yl]-1,2-oxazole-5-carboxamide.
Molecular Properties
| Compound Name | N-[1-(4-fluorophenyl)-2-methylpropan-2-yl]-1,2-oxazole-5-carboxamide |
| PubChem CID | 23732491 |
| Molecular Formula | C14H15FN2O2 |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | N-[1-(4-fluorophenyl)-2-methylpropan-2-yl]-1,2-oxazole-5-carboxamide |
| SMILES | CC(C)(Cc1ccc(F)cc1)NC(=O)c1ccno1 |
| InChI | InChI=1S/C14H15FN2O2/c1-14(2,9-10-3-5-11(15)6-4-10)17-13(18)12-7-8-16-19-12/h3-8H,9H2,1-2H3,(H,17,18) |
| InChIKey | FVOBEAIUMVSCIW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[1-(4-fluorophenyl)-2-methylpropan-2-yl]-1,2-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(4-fluorophenyl)-2-methylpropan-2-yl]-1,2-oxazole-5-carboxamide?
The IUPAC name of N-[1-(4-fluorophenyl)-2-methylpropan-2-yl]-1,2-oxazole-5-carboxamide (CID 23732491) is N-[1-(4-fluorophenyl)-2-methylpropan-2-yl]-1,2-oxazole-5-carboxamide.
What is the SMILES notation for N-[1-(4-fluorophenyl)-2-methylpropan-2-yl]-1,2-oxazole-5-carboxamide?
The canonical SMILES for N-[1-(4-fluorophenyl)-2-methylpropan-2-yl]-1,2-oxazole-5-carboxamide is CC(C)(Cc1ccc(F)cc1)NC(=O)c1ccno1.
What is the InChIKey of N-[1-(4-fluorophenyl)-2-methylpropan-2-yl]-1,2-oxazole-5-carboxamide?
The InChIKey is FVOBEAIUMVSCIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15FN2O2/c1-14(2,9-10-3-5-11(15)6-4-10)17-13(18)12-7-8-16-19-12/h3-8H,9H2,1-2H3,(H,17,18).
What are the key properties of N-[1-(4-fluorophenyl)-2-methylpropan-2-yl]-1,2-oxazole-5-carboxamide?
N-[1-(4-fluorophenyl)-2-methylpropan-2-yl]-1,2-oxazole-5-carboxamide has a molecular weight of 262.28 g/mol, XLogP of 2.56, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(4-fluorophenyl)-2-methylpropan-2-yl]-1,2-oxazole-5-carboxamide is sourced from PubChem (CID 23732491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).