C26H20BrN3O3 — CID 23733323
5-(4-bromophenyl)-N-[2-[4-(dimethylamino)phenyl]-1,3-benzoxazol-5-yl]furan-2-carboxamide (PubChem CID 23733323) has the molecular formula C26H20BrN3O3 and a molecular weight of 502.37 g/mol. Its IUPAC name is 5-(4-bromophenyl)-N-[2-[4-(dimethylamino)phenyl]-1,3-benzoxazol-5-yl]furan-2-carboxamide.
| Compound Name | 5-(4-bromophenyl)-N-[2-[4-(dimethylamino)phenyl]-1,3-benzoxazol-5-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 23733323 |
| Molecular Formula | C26H20BrN3O3 |
| Molecular Weight | 502.37 g/mol |
| Exact Mass | 501.07 |
| IUPAC Name | 5-(4-bromophenyl)-N-[2-[4-(dimethylamino)phenyl]-1,3-benzoxazol-5-yl]furan-2-carboxamide |
| SMILES | CN(C)c1ccc(-c2nc3cc(NC(=O)c4ccc(-c5ccc(Br)cc5)o4)ccc3o2)cc1 |
| InChI | InChI=1S/C26H20BrN3O3/c1-30(2)20-10-5-17(6-11-20)26-29-21-15-19(9-12-23(21)33-26)28-25(31)24-14-13-22(32-24)16-3-7-18(27)8-4-16/h3-15H,1-2H3,(H,28,31) |
| InChIKey | KWVXOLXGUVWPGP-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 71.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.37 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|