About 2-[(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]-N-cyclopentylacetamide
2-[(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]-N-cyclopentylacetamide (PubChem CID 2373476) has the molecular formula C14H15ClN2O2S
and a molecular weight of 310.81 g/mol. Its IUPAC name is 2-[(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]-N-cyclopentylacetamide.
Molecular Properties
| Compound Name | 2-[(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]-N-cyclopentylacetamide |
| PubChem CID | 2373476 |
| Molecular Formula | C14H15ClN2O2S |
| Molecular Weight | 310.81 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 2-[(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]-N-cyclopentylacetamide |
| SMILES | O=C(CSc1nc2cc(Cl)ccc2o1)NC1CCCC1 |
| InChI | InChI=1S/C14H15ClN2O2S/c15-9-5-6-12-11(7-9)17-14(19-12)20-8-13(18)16-10-3-1-2-4-10/h5-7,10H,1-4,8H2,(H,16,18) |
| InChIKey | IDEQEMYFBWFYPV-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.81 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]-N-cyclopentylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]-N-cyclopentylacetamide?
The IUPAC name of 2-[(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]-N-cyclopentylacetamide (CID 2373476) is 2-[(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]-N-cyclopentylacetamide.
What is the SMILES notation for 2-[(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]-N-cyclopentylacetamide?
The canonical SMILES for 2-[(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]-N-cyclopentylacetamide is O=C(CSc1nc2cc(Cl)ccc2o1)NC1CCCC1.
What is the InChIKey of 2-[(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]-N-cyclopentylacetamide?
The InChIKey is IDEQEMYFBWFYPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15ClN2O2S/c15-9-5-6-12-11(7-9)17-14(19-12)20-8-13(18)16-10-3-1-2-4-10/h5-7,10H,1-4,8H2,(H,16,18).
What are the key properties of 2-[(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]-N-cyclopentylacetamide?
2-[(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]-N-cyclopentylacetamide has a molecular weight of 310.81 g/mol, XLogP of 3.63, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]-N-cyclopentylacetamide is sourced from PubChem (CID 2373476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).