About methyl [6-methyl-3-(2-methyl-1,3-thiazol-4-yl)-4-oxochromen-7-yl] carbonate
methyl [6-methyl-3-(2-methyl-1,3-thiazol-4-yl)-4-oxochromen-7-yl] carbonate (PubChem CID 23736537) has the molecular formula C16H13NO5S
and a molecular weight of 331.35 g/mol. Its IUPAC name is methyl [6-methyl-3-(2-methyl-1,3-thiazol-4-yl)-4-oxochromen-7-yl] carbonate.
Molecular Properties
| Compound Name | methyl [6-methyl-3-(2-methyl-1,3-thiazol-4-yl)-4-oxochromen-7-yl] carbonate |
| PubChem CID | 23736537 |
| Molecular Formula | C16H13NO5S |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | methyl [6-methyl-3-(2-methyl-1,3-thiazol-4-yl)-4-oxochromen-7-yl] carbonate |
| SMILES | COC(=O)Oc1cc2occ(-c3csc(C)n3)c(=O)c2cc1C |
| InChI | InChI=1S/C16H13NO5S/c1-8-4-10-14(5-13(8)22-16(19)20-3)21-6-11(15(10)18)12-7-23-9(2)17-12/h4-7H,1-3H3 |
| InChIKey | JGRHBVBRZJPBKS-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 78.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze methyl [6-methyl-3-(2-methyl-1,3-thiazol-4-yl)-4-oxochromen-7-yl] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl [6-methyl-3-(2-methyl-1,3-thiazol-4-yl)-4-oxochromen-7-yl] carbonate?
The IUPAC name of methyl [6-methyl-3-(2-methyl-1,3-thiazol-4-yl)-4-oxochromen-7-yl] carbonate (CID 23736537) is methyl [6-methyl-3-(2-methyl-1,3-thiazol-4-yl)-4-oxochromen-7-yl] carbonate.
What is the SMILES notation for methyl [6-methyl-3-(2-methyl-1,3-thiazol-4-yl)-4-oxochromen-7-yl] carbonate?
The canonical SMILES for methyl [6-methyl-3-(2-methyl-1,3-thiazol-4-yl)-4-oxochromen-7-yl] carbonate is COC(=O)Oc1cc2occ(-c3csc(C)n3)c(=O)c2cc1C.
What is the InChIKey of methyl [6-methyl-3-(2-methyl-1,3-thiazol-4-yl)-4-oxochromen-7-yl] carbonate?
The InChIKey is JGRHBVBRZJPBKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO5S/c1-8-4-10-14(5-13(8)22-16(19)20-3)21-6-11(15(10)18)12-7-23-9(2)17-12/h4-7H,1-3H3.
What are the key properties of methyl [6-methyl-3-(2-methyl-1,3-thiazol-4-yl)-4-oxochromen-7-yl] carbonate?
methyl [6-methyl-3-(2-methyl-1,3-thiazol-4-yl)-4-oxochromen-7-yl] carbonate has a molecular weight of 331.35 g/mol, XLogP of 3.68, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl [6-methyl-3-(2-methyl-1,3-thiazol-4-yl)-4-oxochromen-7-yl] carbonate is sourced from PubChem (CID 23736537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).