C19H18N4O7 — CID 23737273
[1-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-1-oxopropan-2-yl] 5-nitrofuran-2-carboxylate (PubChem CID 23737273) has the molecular formula C19H18N4O7 and a molecular weight of 414.37 g/mol. Its IUPAC name is [1-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-1-oxopropan-2-yl] 5-nitrofuran-2-carboxylate.
| Compound Name | [1-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-1-oxopropan-2-yl] 5-nitrofuran-2-carboxylate |
|---|---|
| PubChem CID | 23737273 |
| Molecular Formula | C19H18N4O7 |
| Molecular Weight | 414.37 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | [1-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-1-oxopropan-2-yl] 5-nitrofuran-2-carboxylate |
| SMILES | Cc1c(NC(=O)C(C)OC(=O)c2ccc([N+](=O)[O-])o2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C19H18N4O7/c1-11-16(18(25)22(21(11)3)13-7-5-4-6-8-13)20-17(24)12(2)29-19(26)14-9-10-15(30-14)23(27)28/h4-10,12H,1-3H3,(H,20,24) |
| InChIKey | UUNPYCFCGQXPMJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 138.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.37 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|