About N-(4-chloro-3-fluorophenyl)-4-methyl-3-(2-methylcyclohexyl)-1,3-thiazol-2-imine
N-(4-chloro-3-fluorophenyl)-4-methyl-3-(2-methylcyclohexyl)-1,3-thiazol-2-imine (PubChem CID 23737292) has the molecular formula C17H20ClFN2S
and a molecular weight of 338.88 g/mol. Its IUPAC name is N-(4-chloro-3-fluorophenyl)-4-methyl-3-(2-methylcyclohexyl)-1,3-thiazol-2-imine.
Molecular Properties
| Compound Name | N-(4-chloro-3-fluorophenyl)-4-methyl-3-(2-methylcyclohexyl)-1,3-thiazol-2-imine |
| PubChem CID | 23737292 |
| Molecular Formula | C17H20ClFN2S |
| Molecular Weight | 338.88 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | N-(4-chloro-3-fluorophenyl)-4-methyl-3-(2-methylcyclohexyl)-1,3-thiazol-2-imine |
| SMILES | Cc1cs/c(=N\c2ccc(Cl)c(F)c2)n1C1CCCCC1C |
| InChI | InChI=1S/C17H20ClFN2S/c1-11-5-3-4-6-16(11)21-12(2)10-22-17(21)20-13-7-8-14(18)15(19)9-13/h7-11,16H,3-6H2,1-2H3/b20-17- |
| InChIKey | BTARTCCPWVQTJS-JZJYNLBNSA-N |
| XLogP | 5.63 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.88 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|
Analyze N-(4-chloro-3-fluorophenyl)-4-methyl-3-(2-methylcyclohexyl)-1,3-thiazol-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-chloro-3-fluorophenyl)-4-methyl-3-(2-methylcyclohexyl)-1,3-thiazol-2-imine?
The IUPAC name of N-(4-chloro-3-fluorophenyl)-4-methyl-3-(2-methylcyclohexyl)-1,3-thiazol-2-imine (CID 23737292) is N-(4-chloro-3-fluorophenyl)-4-methyl-3-(2-methylcyclohexyl)-1,3-thiazol-2-imine.
What is the SMILES notation for N-(4-chloro-3-fluorophenyl)-4-methyl-3-(2-methylcyclohexyl)-1,3-thiazol-2-imine?
The canonical SMILES for N-(4-chloro-3-fluorophenyl)-4-methyl-3-(2-methylcyclohexyl)-1,3-thiazol-2-imine is Cc1cs/c(=N\c2ccc(Cl)c(F)c2)n1C1CCCCC1C.
What is the InChIKey of N-(4-chloro-3-fluorophenyl)-4-methyl-3-(2-methylcyclohexyl)-1,3-thiazol-2-imine?
The InChIKey is BTARTCCPWVQTJS-JZJYNLBNSA-N. The full InChI is InChI=1S/C17H20ClFN2S/c1-11-5-3-4-6-16(11)21-12(2)10-22-17(21)20-13-7-8-14(18)15(19)9-13/h7-11,16H,3-6H2,1-2H3/b20-17-.
What are the key properties of N-(4-chloro-3-fluorophenyl)-4-methyl-3-(2-methylcyclohexyl)-1,3-thiazol-2-imine?
N-(4-chloro-3-fluorophenyl)-4-methyl-3-(2-methylcyclohexyl)-1,3-thiazol-2-imine has a molecular weight of 338.88 g/mol, XLogP of 5.63, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-chloro-3-fluorophenyl)-4-methyl-3-(2-methylcyclohexyl)-1,3-thiazol-2-imine is sourced from PubChem (CID 23737292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).