C15H14N4S — CID 23737878
3-N-benzyl-3-N-phenyl-1,2,4-thiadiazole-3,5-diamine (PubChem CID 23737878) has the molecular formula C15H14N4S and a molecular weight of 282.37 g/mol. Its IUPAC name is 3-N-benzyl-3-N-phenyl-1,2,4-thiadiazole-3,5-diamine.
| Compound Name | 3-N-benzyl-3-N-phenyl-1,2,4-thiadiazole-3,5-diamine |
|---|---|
| PubChem CID | 23737878 |
| Molecular Formula | C15H14N4S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 3-N-benzyl-3-N-phenyl-1,2,4-thiadiazole-3,5-diamine |
| SMILES | Nc1nc(N(Cc2ccccc2)c2ccccc2)ns1 |
| InChI | InChI=1S/C15H14N4S/c16-14-17-15(18-20-14)19(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1-10H,11H2,(H2,16,17,18) |
| InChIKey | YJUBBGWEDPOZMW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |