C20H34O — CID 23738055
(14S,15R)-10,13,15-trimethyl-1,2,3,4,5,6,7,8,9,11,12,14,16,17-tetradecahydrocyclopenta[a]phenanthren-15-ol (PubChem CID 23738055) has the molecular formula C20H34O and a molecular weight of 290.49 g/mol. Its IUPAC name is (14S,15R)-10,13,15-trimethyl-1,2,3,4,5,6,7,8,9,11,12,14,16,17-tetradecahydrocyclopenta[a]phenanthren-15-ol.
| Compound Name | (14S,15R)-10,13,15-trimethyl-1,2,3,4,5,6,7,8,9,11,12,14,16,17-tetradecahydrocyclopenta[a]phenanthren-15-ol |
|---|---|
| PubChem CID | 23738055 |
| Molecular Formula | C20H34O |
| Molecular Weight | 290.49 g/mol |
| Exact Mass | 290.26 |
| IUPAC Name | (14S,15R)-10,13,15-trimethyl-1,2,3,4,5,6,7,8,9,11,12,14,16,17-tetradecahydrocyclopenta[a]phenanthren-15-ol |
| SMILES | CC12CCCCC1CCC1C2CCC2(C)CC[C@@](C)(O)[C@@H]12 |
| InChI | InChI=1S/C20H34O/c1-18-11-9-16-15(17(18)20(3,21)13-12-18)8-7-14-6-4-5-10-19(14,16)2/h14-17,21H,4-13H2,1-3H3/t14?,15?,16?,17-,18?,19?,20+/m0/s1 |
| InChIKey | WYJRZNDPESUBRL-CXIURSOZSA-N |
| XLogP | 5.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.49 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |