C14H17NO5S — CID 23738601
benzyl (4S)-3-formyl-2,2-dimethyl-1,1-dioxo-1,3-thiazolidine-4-carboxylate (PubChem CID 23738601) has the molecular formula C14H17NO5S and a molecular weight of 311.36 g/mol. Its IUPAC name is benzyl (4S)-3-formyl-2,2-dimethyl-1,1-dioxo-1,3-thiazolidine-4-carboxylate.
| Compound Name | benzyl (4S)-3-formyl-2,2-dimethyl-1,1-dioxo-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 23738601 |
| Molecular Formula | C14H17NO5S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | benzyl (4S)-3-formyl-2,2-dimethyl-1,1-dioxo-1,3-thiazolidine-4-carboxylate |
| SMILES | CC1(C)N(C=O)[C@@H](C(=O)OCc2ccccc2)CS1(=O)=O |
| InChI | InChI=1S/C14H17NO5S/c1-14(2)15(10-16)12(9-21(14,18)19)13(17)20-8-11-6-4-3-5-7-11/h3-7,10,12H,8-9H2,1-2H3/t12-/m1/s1 |
| InChIKey | NQITWWBOCAAMCH-GFCCVEGCSA-N |
| XLogP | 0.72 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|