C15H15N3O8 — CID 23738856
[2-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)amino]-2-oxoethyl] 3,4,5-trihydroxybenzoate (PubChem CID 23738856) has the molecular formula C15H15N3O8 and a molecular weight of 365.30 g/mol. Its IUPAC name is [2-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)amino]-2-oxoethyl] 3,4,5-trihydroxybenzoate.
| Compound Name | [2-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)amino]-2-oxoethyl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 23738856 |
| Molecular Formula | C15H15N3O8 |
| Molecular Weight | 365.30 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | [2-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)amino]-2-oxoethyl] 3,4,5-trihydroxybenzoate |
| SMILES | Cn1c(NC(=O)COC(=O)c2cc(O)c(O)c(O)c2)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C15H15N3O8/c1-17-10(5-12(22)18(2)15(17)25)16-11(21)6-26-14(24)7-3-8(19)13(23)9(20)4-7/h3-5,19-20,23H,6H2,1-2H3,(H,16,21) |
| InChIKey | FNVPKYWOJNJZBF-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 160.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.30 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|