About [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 2-[(3-methoxybenzoyl)amino]acetate
[2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 2-[(3-methoxybenzoyl)amino]acetate (PubChem CID 2373890) has the molecular formula C17H15Cl2N3O5
and a molecular weight of 412.23 g/mol. Its IUPAC name is [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 2-[(3-methoxybenzoyl)amino]acetate.
Molecular Properties
| Compound Name | [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 2-[(3-methoxybenzoyl)amino]acetate |
| PubChem CID | 2373890 |
| Molecular Formula | C17H15Cl2N3O5 |
| Molecular Weight | 412.23 g/mol |
| Exact Mass | 411.04 |
| IUPAC Name | [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 2-[(3-methoxybenzoyl)amino]acetate |
| SMILES | COc1cccc(C(=O)NCC(=O)OCC(=O)Nc2ncc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C17H15Cl2N3O5/c1-26-12-4-2-3-10(5-12)17(25)21-8-15(24)27-9-14(23)22-16-13(19)6-11(18)7-20-16/h2-7H,8-9H2,1H3,(H,21,25)(H,20,22,23) |
| InChIKey | IHDZGHBVCWGDFA-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.23 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 2-[(3-methoxybenzoyl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 2-[(3-methoxybenzoyl)amino]acetate?
The IUPAC name of [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 2-[(3-methoxybenzoyl)amino]acetate (CID 2373890) is [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 2-[(3-methoxybenzoyl)amino]acetate.
What is the SMILES notation for [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 2-[(3-methoxybenzoyl)amino]acetate?
The canonical SMILES for [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 2-[(3-methoxybenzoyl)amino]acetate is COc1cccc(C(=O)NCC(=O)OCC(=O)Nc2ncc(Cl)cc2Cl)c1.
What is the InChIKey of [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 2-[(3-methoxybenzoyl)amino]acetate?
The InChIKey is IHDZGHBVCWGDFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15Cl2N3O5/c1-26-12-4-2-3-10(5-12)17(25)21-8-15(24)27-9-14(23)22-16-13(19)6-11(18)7-20-16/h2-7H,8-9H2,1H3,(H,21,25)(H,20,22,23).
What are the key properties of [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 2-[(3-methoxybenzoyl)amino]acetate?
[2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 2-[(3-methoxybenzoyl)amino]acetate has a molecular weight of 412.23 g/mol, XLogP of 2.31, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 2-[(3-methoxybenzoyl)amino]acetate is sourced from PubChem (CID 2373890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).