About 4-[(4,4-dimethyl-5H-dithiolo[3,4-c]quinolin-1-ylidene)amino]aniline
4-[(4,4-dimethyl-5H-dithiolo[3,4-c]quinolin-1-ylidene)amino]aniline (PubChem CID 23739373) has the molecular formula C18H17N3S2
and a molecular weight of 339.49 g/mol. Its IUPAC name is 4-[(4,4-dimethyl-5H-dithiolo[3,4-c]quinolin-1-ylidene)amino]aniline.
Molecular Properties
| Compound Name | 4-[(4,4-dimethyl-5H-dithiolo[3,4-c]quinolin-1-ylidene)amino]aniline |
| PubChem CID | 23739373 |
| Molecular Formula | C18H17N3S2 |
| Molecular Weight | 339.49 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 4-[(4,4-dimethyl-5H-dithiolo[3,4-c]quinolin-1-ylidene)amino]aniline |
| SMILES | CC1(C)Nc2ccccc2-c2c1ss/c2=N\c1ccc(N)cc1 |
| InChI | InChI=1S/C18H17N3S2/c1-18(2)16-15(13-5-3-4-6-14(13)21-18)17(23-22-16)20-12-9-7-11(19)8-10-12/h3-10,21H,19H2,1-2H3/b20-17- |
| InChIKey | RNJUJDXKOWMBST-JZJYNLBNSA-N |
| XLogP | 4.95 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.49 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[(4,4-dimethyl-5H-dithiolo[3,4-c]quinolin-1-ylidene)amino]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4,4-dimethyl-5H-dithiolo[3,4-c]quinolin-1-ylidene)amino]aniline?
The IUPAC name of 4-[(4,4-dimethyl-5H-dithiolo[3,4-c]quinolin-1-ylidene)amino]aniline (CID 23739373) is 4-[(4,4-dimethyl-5H-dithiolo[3,4-c]quinolin-1-ylidene)amino]aniline.
What is the SMILES notation for 4-[(4,4-dimethyl-5H-dithiolo[3,4-c]quinolin-1-ylidene)amino]aniline?
The canonical SMILES for 4-[(4,4-dimethyl-5H-dithiolo[3,4-c]quinolin-1-ylidene)amino]aniline is CC1(C)Nc2ccccc2-c2c1ss/c2=N\c1ccc(N)cc1.
What is the InChIKey of 4-[(4,4-dimethyl-5H-dithiolo[3,4-c]quinolin-1-ylidene)amino]aniline?
The InChIKey is RNJUJDXKOWMBST-JZJYNLBNSA-N. The full InChI is InChI=1S/C18H17N3S2/c1-18(2)16-15(13-5-3-4-6-14(13)21-18)17(23-22-16)20-12-9-7-11(19)8-10-12/h3-10,21H,19H2,1-2H3/b20-17-.
What are the key properties of 4-[(4,4-dimethyl-5H-dithiolo[3,4-c]quinolin-1-ylidene)amino]aniline?
4-[(4,4-dimethyl-5H-dithiolo[3,4-c]quinolin-1-ylidene)amino]aniline has a molecular weight of 339.49 g/mol, XLogP of 4.95, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4,4-dimethyl-5H-dithiolo[3,4-c]quinolin-1-ylidene)amino]aniline is sourced from PubChem (CID 23739373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).