C23H28N2O4S2 — CID 23739611
4-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-(3-formyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)benzamide (PubChem CID 23739611) has the molecular formula C23H28N2O4S2 and a molecular weight of 460.62 g/mol. Its IUPAC name is 4-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-(3-formyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)benzamide.
| Compound Name | 4-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-(3-formyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)benzamide |
|---|---|
| PubChem CID | 23739611 |
| Molecular Formula | C23H28N2O4S2 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | 4-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-(3-formyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)benzamide |
| SMILES | CC1CC(C)CN(S(=O)(=O)c2ccc(C(=O)Nc3sc4c(c3C=O)CCCC4)cc2)C1 |
| InChI | InChI=1S/C23H28N2O4S2/c1-15-11-16(2)13-25(12-15)31(28,29)18-9-7-17(8-10-18)22(27)24-23-20(14-26)19-5-3-4-6-21(19)30-23/h7-10,14-16H,3-6,11-13H2,1-2H3,(H,24,27) |
| InChIKey | CRJCCIVBRMKHDF-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|