C18H18N4O3S — CID 23739700
2-[1-oxo-1-[4-(1,3-thiazol-2-yl)piperazin-1-yl]propan-2-yl]isoindole-1,3-dione (PubChem CID 23739700) has the molecular formula C18H18N4O3S and a molecular weight of 370.43 g/mol. Its IUPAC name is 2-[1-oxo-1-[4-(1,3-thiazol-2-yl)piperazin-1-yl]propan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[1-oxo-1-[4-(1,3-thiazol-2-yl)piperazin-1-yl]propan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 23739700 |
| Molecular Formula | C18H18N4O3S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 2-[1-oxo-1-[4-(1,3-thiazol-2-yl)piperazin-1-yl]propan-2-yl]isoindole-1,3-dione |
| SMILES | CC(C(=O)N1CCN(c2nccs2)CC1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H18N4O3S/c1-12(22-16(24)13-4-2-3-5-14(13)17(22)25)15(23)20-7-9-21(10-8-20)18-19-6-11-26-18/h2-6,11-12H,7-10H2,1H3 |
| InChIKey | FIVOUASXCAOVQC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|