About [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 6-chloropyridine-3-carboxylate
[2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 6-chloropyridine-3-carboxylate (PubChem CID 2373983) has the molecular formula C13H8Cl3N3O3
and a molecular weight of 360.58 g/mol. Its IUPAC name is [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 6-chloropyridine-3-carboxylate.
Molecular Properties
| Compound Name | [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 6-chloropyridine-3-carboxylate |
| PubChem CID | 2373983 |
| Molecular Formula | C13H8Cl3N3O3 |
| Molecular Weight | 360.58 g/mol |
| Exact Mass | 358.96 |
| IUPAC Name | [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 6-chloropyridine-3-carboxylate |
| SMILES | O=C(COC(=O)c1ccc(Cl)nc1)Nc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C13H8Cl3N3O3/c14-8-3-9(15)12(18-5-8)19-11(20)6-22-13(21)7-1-2-10(16)17-4-7/h1-5H,6H2,(H,18,19,20) |
| InChIKey | QQAOZVKLMYMGJH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.58 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 6-chloropyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 6-chloropyridine-3-carboxylate?
The IUPAC name of [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 6-chloropyridine-3-carboxylate (CID 2373983) is [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 6-chloropyridine-3-carboxylate.
What is the SMILES notation for [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 6-chloropyridine-3-carboxylate?
The canonical SMILES for [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 6-chloropyridine-3-carboxylate is O=C(COC(=O)c1ccc(Cl)nc1)Nc1ncc(Cl)cc1Cl.
What is the InChIKey of [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 6-chloropyridine-3-carboxylate?
The InChIKey is QQAOZVKLMYMGJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8Cl3N3O3/c14-8-3-9(15)12(18-5-8)19-11(20)6-22-13(21)7-1-2-10(16)17-4-7/h1-5H,6H2,(H,18,19,20).
What are the key properties of [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 6-chloropyridine-3-carboxylate?
[2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 6-chloropyridine-3-carboxylate has a molecular weight of 360.58 g/mol, XLogP of 3.23, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 6-chloropyridine-3-carboxylate is sourced from PubChem (CID 2373983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).