About 3-(3,3-diphenylpropyl)-4-(4-nitrophenyl)-N-pyridin-3-yl-1,3-thiazol-2-imine
3-(3,3-diphenylpropyl)-4-(4-nitrophenyl)-N-pyridin-3-yl-1,3-thiazol-2-imine (PubChem CID 23740403) has the molecular formula C29H24N4O2S
and a molecular weight of 492.60 g/mol. Its IUPAC name is 3-(3,3-diphenylpropyl)-4-(4-nitrophenyl)-N-pyridin-3-yl-1,3-thiazol-2-imine.
Molecular Properties
| Compound Name | 3-(3,3-diphenylpropyl)-4-(4-nitrophenyl)-N-pyridin-3-yl-1,3-thiazol-2-imine |
| PubChem CID | 23740403 |
| Molecular Formula | C29H24N4O2S |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | 3-(3,3-diphenylpropyl)-4-(4-nitrophenyl)-N-pyridin-3-yl-1,3-thiazol-2-imine |
| SMILES | O=[N+]([O-])c1ccc(-c2cs/c(=N\c3cccnc3)n2CCC(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H24N4O2S/c34-33(35)26-15-13-24(14-16-26)28-21-36-29(31-25-12-7-18-30-20-25)32(28)19-17-27(22-8-3-1-4-9-22)23-10-5-2-6-11-23/h1-16,18,20-21,27H,17,19H2/b31-29- |
| InChIKey | SYOTUUFNYBMXIR-YCNYHXFESA-N |
| XLogP | 6.97 |
| TPSA | 73.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,3-diphenylpropyl)-4-(4-nitrophenyl)-N-pyridin-3-yl-1,3-thiazol-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,3-diphenylpropyl)-4-(4-nitrophenyl)-N-pyridin-3-yl-1,3-thiazol-2-imine?
The IUPAC name of 3-(3,3-diphenylpropyl)-4-(4-nitrophenyl)-N-pyridin-3-yl-1,3-thiazol-2-imine (CID 23740403) is 3-(3,3-diphenylpropyl)-4-(4-nitrophenyl)-N-pyridin-3-yl-1,3-thiazol-2-imine.
What is the SMILES notation for 3-(3,3-diphenylpropyl)-4-(4-nitrophenyl)-N-pyridin-3-yl-1,3-thiazol-2-imine?
The canonical SMILES for 3-(3,3-diphenylpropyl)-4-(4-nitrophenyl)-N-pyridin-3-yl-1,3-thiazol-2-imine is O=[N+]([O-])c1ccc(-c2cs/c(=N\c3cccnc3)n2CCC(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 3-(3,3-diphenylpropyl)-4-(4-nitrophenyl)-N-pyridin-3-yl-1,3-thiazol-2-imine?
The InChIKey is SYOTUUFNYBMXIR-YCNYHXFESA-N. The full InChI is InChI=1S/C29H24N4O2S/c34-33(35)26-15-13-24(14-16-26)28-21-36-29(31-25-12-7-18-30-20-25)32(28)19-17-27(22-8-3-1-4-9-22)23-10-5-2-6-11-23/h1-16,18,20-21,27H,17,19H2/b31-29-.
What are the key properties of 3-(3,3-diphenylpropyl)-4-(4-nitrophenyl)-N-pyridin-3-yl-1,3-thiazol-2-imine?
3-(3,3-diphenylpropyl)-4-(4-nitrophenyl)-N-pyridin-3-yl-1,3-thiazol-2-imine has a molecular weight of 492.60 g/mol, XLogP of 6.97, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,3-diphenylpropyl)-4-(4-nitrophenyl)-N-pyridin-3-yl-1,3-thiazol-2-imine is sourced from PubChem (CID 23740403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).