C11H16N2O2 — CID 23741260
N,N,1,4,6-pentamethyl-2-oxopyridine-3-carboxamide (PubChem CID 23741260) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is N,N,1,4,6-pentamethyl-2-oxopyridine-3-carboxamide.
| Compound Name | N,N,1,4,6-pentamethyl-2-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 23741260 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | N,N,1,4,6-pentamethyl-2-oxopyridine-3-carboxamide |
| SMILES | Cc1cc(C)n(C)c(=O)c1C(=O)N(C)C |
| InChI | InChI=1S/C11H16N2O2/c1-7-6-8(2)13(5)11(15)9(7)10(14)12(3)4/h6H,1-5H3 |
| InChIKey | KGNIRDDOCTXDTB-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |