C24H21Br2N3O4 — CID 23741423
1-N,3-N-bis[1-(4-bromophenyl)ethyl]-5-nitrobenzene-1,3-dicarboxamide (PubChem CID 23741423) has the molecular formula C24H21Br2N3O4 and a molecular weight of 575.26 g/mol. Its IUPAC name is 1-N,3-N-bis[1-(4-bromophenyl)ethyl]-5-nitrobenzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis[1-(4-bromophenyl)ethyl]-5-nitrobenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 23741423 |
| Molecular Formula | C24H21Br2N3O4 |
| Molecular Weight | 575.26 g/mol |
| Exact Mass | 572.99 |
| IUPAC Name | 1-N,3-N-bis[1-(4-bromophenyl)ethyl]-5-nitrobenzene-1,3-dicarboxamide |
| SMILES | CC(NC(=O)c1cc(C(=O)NC(C)c2ccc(Br)cc2)cc([N+](=O)[O-])c1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C24H21Br2N3O4/c1-14(16-3-7-20(25)8-4-16)27-23(30)18-11-19(13-22(12-18)29(32)33)24(31)28-15(2)17-5-9-21(26)10-6-17/h3-15H,1-2H3,(H,27,30)(H,28,31) |
| InChIKey | MAFNTTGKPRINDX-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.26 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|