About 8-tert-butyl-1,3-diazaspiro[4.5]decane-2,4-dione
8-tert-butyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 2374182) has the molecular formula C12H20N2O2
and a molecular weight of 224.30 g/mol. Its IUPAC name is 8-tert-butyl-1,3-diazaspiro[4.5]decane-2,4-dione.
Molecular Properties
| Compound Name | 8-tert-butyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| PubChem CID | 2374182 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 8-tert-butyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CC(C)(C)C1CCC2(CC1)NC(=O)NC2=O |
| InChI | InChI=1S/C12H20N2O2/c1-11(2,3)8-4-6-12(7-5-8)9(15)13-10(16)14-12/h8H,4-7H2,1-3H3,(H2,13,14,15,16) |
| InChIKey | RQUKBTLNDXLLEA-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 8-tert-butyl-1,3-diazaspiro[4.5]decane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-tert-butyl-1,3-diazaspiro[4.5]decane-2,4-dione?
The IUPAC name of 8-tert-butyl-1,3-diazaspiro[4.5]decane-2,4-dione (CID 2374182) is 8-tert-butyl-1,3-diazaspiro[4.5]decane-2,4-dione.
What is the SMILES notation for 8-tert-butyl-1,3-diazaspiro[4.5]decane-2,4-dione?
The canonical SMILES for 8-tert-butyl-1,3-diazaspiro[4.5]decane-2,4-dione is CC(C)(C)C1CCC2(CC1)NC(=O)NC2=O.
What is the InChIKey of 8-tert-butyl-1,3-diazaspiro[4.5]decane-2,4-dione?
The InChIKey is RQUKBTLNDXLLEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O2/c1-11(2,3)8-4-6-12(7-5-8)9(15)13-10(16)14-12/h8H,4-7H2,1-3H3,(H2,13,14,15,16).
What are the key properties of 8-tert-butyl-1,3-diazaspiro[4.5]decane-2,4-dione?
8-tert-butyl-1,3-diazaspiro[4.5]decane-2,4-dione has a molecular weight of 224.30 g/mol, XLogP of 1.80, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-tert-butyl-1,3-diazaspiro[4.5]decane-2,4-dione is sourced from PubChem (CID 2374182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).