C18H11F4N3O3 — CID 23744739
[1-oxo-1-(2,3,5,6-tetrafluoroanilino)propan-2-yl] quinoxaline-2-carboxylate (PubChem CID 23744739) has the molecular formula C18H11F4N3O3 and a molecular weight of 393.30 g/mol. Its IUPAC name is [1-oxo-1-(2,3,5,6-tetrafluoroanilino)propan-2-yl] quinoxaline-2-carboxylate.
| Compound Name | [1-oxo-1-(2,3,5,6-tetrafluoroanilino)propan-2-yl] quinoxaline-2-carboxylate |
|---|---|
| PubChem CID | 23744739 |
| Molecular Formula | C18H11F4N3O3 |
| Molecular Weight | 393.30 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | [1-oxo-1-(2,3,5,6-tetrafluoroanilino)propan-2-yl] quinoxaline-2-carboxylate |
| SMILES | CC(OC(=O)c1cnc2ccccc2n1)C(=O)Nc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C18H11F4N3O3/c1-8(17(26)25-16-14(21)9(19)6-10(20)15(16)22)28-18(27)13-7-23-11-4-2-3-5-12(11)24-13/h2-8H,1H3,(H,25,26) |
| InChIKey | NBEAQIDINWHOHN-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.30 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|