C25H28BFO5S — CID 23746653
4-[(Z)-4-[(4R,7aS)-6-hydroxy-1,1-dioxo-3-propyl-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]-2-phenylbut-1-enyl]-2-fluorophenol (PubChem CID 23746653) has the molecular formula C25H28BFO5S and a molecular weight of 470.37 g/mol. Its IUPAC name is 4-[(Z)-4-[(4R,7aS)-6-hydroxy-1,1-dioxo-3-propyl-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]-2-phenylbut-1-enyl]-2-fluorophenol.
| Compound Name | 4-[(Z)-4-[(4R,7aS)-6-hydroxy-1,1-dioxo-3-propyl-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]-2-phenylbut-1-enyl]-2-fluorophenol |
|---|---|
| PubChem CID | 23746653 |
| Molecular Formula | C25H28BFO5S |
| Molecular Weight | 470.37 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | 4-[(Z)-4-[(4R,7aS)-6-hydroxy-1,1-dioxo-3-propyl-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]-2-phenylbut-1-enyl]-2-fluorophenol |
| SMILES | CCCC1=C2[C@@H](CC/C(=C/c3ccc(O)c(F)c3)c3ccccc3)OB(O)C[C@@H]2S(=O)(=O)C1 |
| InChI | InChI=1S/C25H28BFO5S/c1-2-6-20-16-33(30,31)24-15-26(29)32-23(25(20)24)12-10-19(18-7-4-3-5-8-18)13-17-9-11-22(28)21(27)14-17/h3-5,7-9,11,13-14,23-24,28-29H,2,6,10,12,15-16H2,1H3/b19-13-/t23-,24+/m1/s1 |
| InChIKey | PWGIFQZZMWFKQU-ZLBJXFNLSA-N |
| XLogP | 4.63 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.37 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|