C23H27BO5S — CID 23746663
4-[(E)-4-[(4R,7aS)-6-hydroxy-3-methyl-1,1-dioxo-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]-2-ethylbut-1-enyl]naphthalen-1-ol (PubChem CID 23746663) has the molecular formula C23H27BO5S and a molecular weight of 426.34 g/mol. Its IUPAC name is 4-[(E)-4-[(4R,7aS)-6-hydroxy-3-methyl-1,1-dioxo-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]-2-ethylbut-1-enyl]naphthalen-1-ol.
| Compound Name | 4-[(E)-4-[(4R,7aS)-6-hydroxy-3-methyl-1,1-dioxo-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]-2-ethylbut-1-enyl]naphthalen-1-ol |
|---|---|
| PubChem CID | 23746663 |
| Molecular Formula | C23H27BO5S |
| Molecular Weight | 426.34 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 4-[(E)-4-[(4R,7aS)-6-hydroxy-3-methyl-1,1-dioxo-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]-2-ethylbut-1-enyl]naphthalen-1-ol |
| SMILES | CC/C(=C\c1ccc(O)c2ccccc12)CC[C@H]1OB(O)C[C@H]2C1=C(C)CS2(=O)=O |
| InChI | InChI=1S/C23H27BO5S/c1-3-16(12-17-9-10-20(25)19-7-5-4-6-18(17)19)8-11-21-23-15(2)14-30(27,28)22(23)13-24(26)29-21/h4-7,9-10,12,21-22,25-26H,3,8,11,13-14H2,1-2H3/b16-12+/t21-,22+/m1/s1 |
| InChIKey | BTZQRRWVTIDWGW-FFBCTHBHSA-N |
| XLogP | 4.11 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.34 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|