C24H27FO6S — CID 23746675
2-fluoro-4-[(Z,5R)-5-hydroxy-5-[(2R)-2-(hydroxymethyl)-4-(methoxymethyl)-1,1-dioxo-2,5-dihydrothiophen-3-yl]-2-phenylpent-1-enyl]phenol (PubChem CID 23746675) has the molecular formula C24H27FO6S and a molecular weight of 462.54 g/mol. Its IUPAC name is 2-fluoro-4-[(Z,5R)-5-hydroxy-5-[(2R)-2-(hydroxymethyl)-4-(methoxymethyl)-1,1-dioxo-2,5-dihydrothiophen-3-yl]-2-phenylpent-1-enyl]phenol.
| Compound Name | 2-fluoro-4-[(Z,5R)-5-hydroxy-5-[(2R)-2-(hydroxymethyl)-4-(methoxymethyl)-1,1-dioxo-2,5-dihydrothiophen-3-yl]-2-phenylpent-1-enyl]phenol |
|---|---|
| PubChem CID | 23746675 |
| Molecular Formula | C24H27FO6S |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 2-fluoro-4-[(Z,5R)-5-hydroxy-5-[(2R)-2-(hydroxymethyl)-4-(methoxymethyl)-1,1-dioxo-2,5-dihydrothiophen-3-yl]-2-phenylpent-1-enyl]phenol |
| SMILES | COCC1=C([C@H](O)CC/C(=C/c2ccc(O)c(F)c2)c2ccccc2)[C@H](CO)S(=O)(=O)C1 |
| InChI | InChI=1S/C24H27FO6S/c1-31-14-19-15-32(29,30)23(13-26)24(19)22(28)10-8-18(17-5-3-2-4-6-17)11-16-7-9-21(27)20(25)12-16/h2-7,9,11-12,22-23,26-28H,8,10,13-15H2,1H3/b18-11-/t22-,23+/m1/s1 |
| InChIKey | YEHOQKCXCBIYFT-CWHOZVNYSA-N |
| XLogP | 2.95 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|