C22H22BNO6S — CID 23747712
(3aS,8S,9aS,9bR)-6-hydroxy-5-(hydroxymethyl)-8-(4-hydroxyphenyl)-2-(thiophen-2-ylmethyl)-3a,4,8,9,9a,9b-hexahydrooxaborinino[4,3-e]isoindole-1,3-dione (PubChem CID 23747712) has the molecular formula C22H22BNO6S and a molecular weight of 439.30 g/mol. Its IUPAC name is (3aS,8S,9aS,9bR)-6-hydroxy-5-(hydroxymethyl)-8-(4-hydroxyphenyl)-2-(thiophen-2-ylmethyl)-3a,4,8,9,9a,9b-hexahydrooxaborinino[4,3-e]isoindole-1,3-dione.
| Compound Name | (3aS,8S,9aS,9bR)-6-hydroxy-5-(hydroxymethyl)-8-(4-hydroxyphenyl)-2-(thiophen-2-ylmethyl)-3a,4,8,9,9a,9b-hexahydrooxaborinino[4,3-e]isoindole-1,3-dione |
|---|---|
| PubChem CID | 23747712 |
| Molecular Formula | C22H22BNO6S |
| Molecular Weight | 439.30 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | (3aS,8S,9aS,9bR)-6-hydroxy-5-(hydroxymethyl)-8-(4-hydroxyphenyl)-2-(thiophen-2-ylmethyl)-3a,4,8,9,9a,9b-hexahydrooxaborinino[4,3-e]isoindole-1,3-dione |
| SMILES | O=C1[C@H]2[C@H](CC(CO)=C3B(O)O[C@H](c4ccc(O)cc4)C[C@H]32)C(=O)N1Cc1cccs1 |
| InChI | InChI=1S/C22H22BNO6S/c25-11-13-8-17-19(22(28)24(21(17)27)10-15-2-1-7-31-15)16-9-18(30-23(29)20(13)16)12-3-5-14(26)6-4-12/h1-7,16-19,25-26,29H,8-11H2/t16-,17-,18-,19+/m0/s1 |
| InChIKey | HAXPHLOZEQSKGR-CADBVGFASA-N |
| XLogP | 2.05 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.30 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|