C18H20BNO5 — CID 23747718
(3aS,8S,9aS,9bR)-6-hydroxy-8-(3-hydroxyphenyl)-2,5-dimethyl-3a,4,8,9,9a,9b-hexahydrooxaborinino[4,3-e]isoindole-1,3-dione (PubChem CID 23747718) has the molecular formula C18H20BNO5 and a molecular weight of 341.17 g/mol. Its IUPAC name is (3aS,8S,9aS,9bR)-6-hydroxy-8-(3-hydroxyphenyl)-2,5-dimethyl-3a,4,8,9,9a,9b-hexahydrooxaborinino[4,3-e]isoindole-1,3-dione.
| Compound Name | (3aS,8S,9aS,9bR)-6-hydroxy-8-(3-hydroxyphenyl)-2,5-dimethyl-3a,4,8,9,9a,9b-hexahydrooxaborinino[4,3-e]isoindole-1,3-dione |
|---|---|
| PubChem CID | 23747718 |
| Molecular Formula | C18H20BNO5 |
| Molecular Weight | 341.17 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | (3aS,8S,9aS,9bR)-6-hydroxy-8-(3-hydroxyphenyl)-2,5-dimethyl-3a,4,8,9,9a,9b-hexahydrooxaborinino[4,3-e]isoindole-1,3-dione |
| SMILES | CC1=C2B(O)O[C@H](c3cccc(O)c3)C[C@H]2[C@H]2C(=O)N(C)C(=O)[C@H]2C1 |
| InChI | InChI=1S/C18H20BNO5/c1-9-6-13-15(18(23)20(2)17(13)22)12-8-14(25-19(24)16(9)12)10-4-3-5-11(21)7-10/h3-5,7,12-15,21,24H,6,8H2,1-2H3/t12-,13-,14-,15+/m0/s1 |
| InChIKey | UEUMYCHGNVXVGW-ZQDZILKHSA-N |
| XLogP | 1.44 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.17 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|