C25H28FN3O4 — CID 23747875
(3S,6S,7R,8aR)-N-[(4-fluorophenyl)methyl]-6-(4-hydroxyphenyl)-3-(2-methylpropyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide (PubChem CID 23747875) has the molecular formula C25H28FN3O4 and a molecular weight of 453.51 g/mol. Its IUPAC name is (3S,6S,7R,8aR)-N-[(4-fluorophenyl)methyl]-6-(4-hydroxyphenyl)-3-(2-methylpropyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide.
| Compound Name | (3S,6S,7R,8aR)-N-[(4-fluorophenyl)methyl]-6-(4-hydroxyphenyl)-3-(2-methylpropyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 23747875 |
| Molecular Formula | C25H28FN3O4 |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | (3S,6S,7R,8aR)-N-[(4-fluorophenyl)methyl]-6-(4-hydroxyphenyl)-3-(2-methylpropyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide |
| SMILES | CC(C)C[C@@H]1NC(=O)[C@H]2C[C@@H](C(=O)NCc3ccc(F)cc3)[C@@H](c3ccc(O)cc3)N2C1=O |
| InChI | InChI=1S/C25H28FN3O4/c1-14(2)11-20-25(33)29-21(24(32)28-20)12-19(22(29)16-5-9-18(30)10-6-16)23(31)27-13-15-3-7-17(26)8-4-15/h3-10,14,19-22,30H,11-13H2,1-2H3,(H,27,31)(H,28,32)/t19-,20+,21-,22-/m1/s1 |
| InChIKey | TUWCNJQWDGGLLC-CIAFKFPVSA-N |
| XLogP | 2.65 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |