C40H36FN3O9 — CID 23748512
[(2R,3R,4S,5S,6S)-2-(hydroxymethyl)-6-methoxy-4,5-bis[(2-phenylphenyl)carbamoyloxy]oxan-3-yl] N-(3-fluorophenyl)carbamate (PubChem CID 23748512) has the molecular formula C40H36FN3O9 and a molecular weight of 721.74 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6S)-2-(hydroxymethyl)-6-methoxy-4,5-bis[(2-phenylphenyl)carbamoyloxy]oxan-3-yl] N-(3-fluorophenyl)carbamate.
| Compound Name | [(2R,3R,4S,5S,6S)-2-(hydroxymethyl)-6-methoxy-4,5-bis[(2-phenylphenyl)carbamoyloxy]oxan-3-yl] N-(3-fluorophenyl)carbamate |
|---|---|
| PubChem CID | 23748512 |
| Molecular Formula | C40H36FN3O9 |
| Molecular Weight | 721.74 g/mol |
| Exact Mass | 721.24 |
| IUPAC Name | [(2R,3R,4S,5S,6S)-2-(hydroxymethyl)-6-methoxy-4,5-bis[(2-phenylphenyl)carbamoyloxy]oxan-3-yl] N-(3-fluorophenyl)carbamate |
| SMILES | CO[C@H]1O[C@H](CO)[C@@H](OC(=O)Nc2cccc(F)c2)[C@H](OC(=O)Nc2ccccc2-c2ccccc2)[C@@H]1OC(=O)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C40H36FN3O9/c1-49-37-36(53-40(48)44-32-22-11-9-20-30(32)26-15-6-3-7-16-26)35(34(33(24-45)50-37)51-38(46)42-28-18-12-17-27(41)23-28)52-39(47)43-31-21-10-8-19-29(31)25-13-4-2-5-14-25/h2-23,33-37,45H,24H2,1H3,(H,42,46)(H,43,47)(H,44,48)/t33-,34-,35+,36+,37+/m1/s1 |
| InChIKey | QYTCIACBOCCDSI-DWCHZDDLSA-N |
| XLogP | 7.68 |
| TPSA | 153.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.74 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|