C24H24FN3O4 — CID 23748548
(3R,5R,6S,9S)-N-[(4-fluorophenyl)methyl]-6-(4-hydroxyphenyl)-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecane-5-carboxamide (PubChem CID 23748548) has the molecular formula C24H24FN3O4 and a molecular weight of 437.47 g/mol. Its IUPAC name is (3R,5R,6S,9S)-N-[(4-fluorophenyl)methyl]-6-(4-hydroxyphenyl)-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecane-5-carboxamide.
| Compound Name | (3R,5R,6S,9S)-N-[(4-fluorophenyl)methyl]-6-(4-hydroxyphenyl)-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecane-5-carboxamide |
|---|---|
| PubChem CID | 23748548 |
| Molecular Formula | C24H24FN3O4 |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | (3R,5R,6S,9S)-N-[(4-fluorophenyl)methyl]-6-(4-hydroxyphenyl)-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecane-5-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)[C@@H]1C[C@@H]2C(=O)N3CCC[C@H]3C(=O)N2[C@@H]1c1ccc(O)cc1 |
| InChI | InChI=1S/C24H24FN3O4/c25-16-7-3-14(4-8-16)13-26-22(30)18-12-20-23(31)27-11-1-2-19(27)24(32)28(20)21(18)15-5-9-17(29)10-6-15/h3-10,18-21,29H,1-2,11-13H2,(H,26,30)/t18-,19+,20-,21-/m1/s1 |
| InChIKey | UAGRCUBXCLLEBX-PLACYPQZSA-N |
| XLogP | 2.11 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |