C27H33FN4O4 — CID 23748552
(3S,6R,7S,8aS)-3-[4-(dimethylamino)butyl]-N-[(4-fluorophenyl)methyl]-6-(4-hydroxyphenyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide (PubChem CID 23748552) has the molecular formula C27H33FN4O4 and a molecular weight of 496.58 g/mol. Its IUPAC name is (3S,6R,7S,8aS)-3-[4-(dimethylamino)butyl]-N-[(4-fluorophenyl)methyl]-6-(4-hydroxyphenyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide.
| Compound Name | (3S,6R,7S,8aS)-3-[4-(dimethylamino)butyl]-N-[(4-fluorophenyl)methyl]-6-(4-hydroxyphenyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 23748552 |
| Molecular Formula | C27H33FN4O4 |
| Molecular Weight | 496.58 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | (3S,6R,7S,8aS)-3-[4-(dimethylamino)butyl]-N-[(4-fluorophenyl)methyl]-6-(4-hydroxyphenyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide |
| SMILES | CN(C)CCCC[C@@H]1NC(=O)[C@@H]2C[C@H](C(=O)NCc3ccc(F)cc3)[C@H](c3ccc(O)cc3)N2C1=O |
| InChI | InChI=1S/C27H33FN4O4/c1-31(2)14-4-3-5-22-27(36)32-23(26(35)30-22)15-21(24(32)18-8-12-20(33)13-9-18)25(34)29-16-17-6-10-19(28)11-7-17/h6-13,21-24,33H,3-5,14-16H2,1-2H3,(H,29,34)(H,30,35)/t21-,22-,23-,24-/m0/s1 |
| InChIKey | HBXJVMMTVBDTMD-ZJZGAYNASA-N |
| XLogP | 2.34 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.58 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|