C28H25F3N2O3 — CID 23748599
(3R,4R)-2-(2,3-dihydro-1H-inden-2-yl)-3-[4-(hydroxymethyl)phenyl]-1-oxo-N-(2,2,2-trifluoroethyl)-3,4-dihydroisoquinoline-4-carboxamide (PubChem CID 23748599) has the molecular formula C28H25F3N2O3 and a molecular weight of 494.51 g/mol. Its IUPAC name is (3R,4R)-2-(2,3-dihydro-1H-inden-2-yl)-3-[4-(hydroxymethyl)phenyl]-1-oxo-N-(2,2,2-trifluoroethyl)-3,4-dihydroisoquinoline-4-carboxamide.
| Compound Name | (3R,4R)-2-(2,3-dihydro-1H-inden-2-yl)-3-[4-(hydroxymethyl)phenyl]-1-oxo-N-(2,2,2-trifluoroethyl)-3,4-dihydroisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 23748599 |
| Molecular Formula | C28H25F3N2O3 |
| Molecular Weight | 494.51 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | (3R,4R)-2-(2,3-dihydro-1H-inden-2-yl)-3-[4-(hydroxymethyl)phenyl]-1-oxo-N-(2,2,2-trifluoroethyl)-3,4-dihydroisoquinoline-4-carboxamide |
| SMILES | O=C(NCC(F)(F)F)[C@@H]1c2ccccc2C(=O)N(C2Cc3ccccc3C2)[C@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C28H25F3N2O3/c29-28(30,31)16-32-26(35)24-22-7-3-4-8-23(22)27(36)33(21-13-19-5-1-2-6-20(19)14-21)25(24)18-11-9-17(15-34)10-12-18/h1-12,21,24-25,34H,13-16H2,(H,32,35)/t24-,25+/m1/s1 |
| InChIKey | KPIDGHKXTGZUIH-RPBOFIJWSA-N |
| XLogP | 4.31 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.51 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |