C38H40N2O6Si — CID 23748659
(3R,3'R,4'S,5'R)-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-1-[[4-(3-oxo-1,4-benzoxazin-4-yl)phenyl]methyl]spiro[indole-3,2'-oxolane]-2-one (PubChem CID 23748659) has the molecular formula C38H40N2O6Si and a molecular weight of 648.83 g/mol. Its IUPAC name is (3R,3'R,4'S,5'R)-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-1-[[4-(3-oxo-1,4-benzoxazin-4-yl)phenyl]methyl]spiro[indole-3,2'-oxolane]-2-one.
| Compound Name | (3R,3'R,4'S,5'R)-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-1-[[4-(3-oxo-1,4-benzoxazin-4-yl)phenyl]methyl]spiro[indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23748659 |
| Molecular Formula | C38H40N2O6Si |
| Molecular Weight | 648.83 g/mol |
| Exact Mass | 648.27 |
| IUPAC Name | (3R,3'R,4'S,5'R)-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-1-[[4-(3-oxo-1,4-benzoxazin-4-yl)phenyl]methyl]spiro[indole-3,2'-oxolane]-2-one |
| SMILES | COc1ccc([Si](C)(C)[C@@H]2[C@@H](CCO)O[C@]3(C(=O)N(Cc4ccc(N5C(=O)COc6ccccc65)cc4)c4ccccc43)[C@H]2C)cc1 |
| InChI | InChI=1S/C38H40N2O6Si/c1-25-36(47(3,4)29-19-17-28(44-2)18-20-29)34(21-22-41)46-38(25)30-9-5-6-10-31(30)39(37(38)43)23-26-13-15-27(16-14-26)40-32-11-7-8-12-33(32)45-24-35(40)42/h5-20,25,34,36,41H,21-24H2,1-4H3/t25-,34+,36-,38+/m0/s1 |
| InChIKey | JAUZRRNKBPVAKN-SUXMQFDBSA-N |
| XLogP | 5.90 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.83 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|