C30H39BrN2O5Si — CID 23748730
(3S,3'S,4'R,5'S)-7-bromo-5'-[2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]-4'-[(4-methoxyphenyl)-dimethylsilyl]-1,3',5-trimethylspiro[indole-3,2'-oxolane]-2-one (PubChem CID 23748730) has the molecular formula C30H39BrN2O5Si and a molecular weight of 615.64 g/mol. Its IUPAC name is (3S,3'S,4'R,5'S)-7-bromo-5'-[2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]-4'-[(4-methoxyphenyl)-dimethylsilyl]-1,3',5-trimethylspiro[indole-3,2'-oxolane]-2-one.
| Compound Name | (3S,3'S,4'R,5'S)-7-bromo-5'-[2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]-4'-[(4-methoxyphenyl)-dimethylsilyl]-1,3',5-trimethylspiro[indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23748730 |
| Molecular Formula | C30H39BrN2O5Si |
| Molecular Weight | 615.64 g/mol |
| Exact Mass | 614.18 |
| IUPAC Name | (3S,3'S,4'R,5'S)-7-bromo-5'-[2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]-4'-[(4-methoxyphenyl)-dimethylsilyl]-1,3',5-trimethylspiro[indole-3,2'-oxolane]-2-one |
| SMILES | COc1ccc([Si](C)(C)[C@H]2[C@H](CC(=O)N3CCC[C@H]3CO)O[C@@]3(C(=O)N(C)c4c(Br)cc(C)cc43)[C@@H]2C)cc1 |
| InChI | InChI=1S/C30H39BrN2O5Si/c1-18-14-23-27(24(31)15-18)32(3)29(36)30(23)19(2)28(39(5,6)22-11-9-21(37-4)10-12-22)25(38-30)16-26(35)33-13-7-8-20(33)17-34/h9-12,14-15,19-20,25,28,34H,7-8,13,16-17H2,1-6H3/t19-,20+,25+,28-,30+/m1/s1 |
| InChIKey | MDXPUVBPQQCXQH-IHZJDPGQSA-N |
| XLogP | 4.33 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.64 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|