C24H39N3O3 — CID 23749429
methyl 8-[(2E)-2-[[4-(dibutylamino)phenyl]methylidene]hydrazinyl]-8-oxooctanoate (PubChem CID 23749429) has the molecular formula C24H39N3O3 and a molecular weight of 417.59 g/mol. Its IUPAC name is methyl 8-[(2E)-2-[[4-(dibutylamino)phenyl]methylidene]hydrazinyl]-8-oxooctanoate.
| Compound Name | methyl 8-[(2E)-2-[[4-(dibutylamino)phenyl]methylidene]hydrazinyl]-8-oxooctanoate |
|---|---|
| PubChem CID | 23749429 |
| Molecular Formula | C24H39N3O3 |
| Molecular Weight | 417.59 g/mol |
| Exact Mass | 417.30 |
| IUPAC Name | methyl 8-[(2E)-2-[[4-(dibutylamino)phenyl]methylidene]hydrazinyl]-8-oxooctanoate |
| SMILES | CCCCN(CCCC)c1ccc(/C=N/NC(=O)CCCCCCC(=O)OC)cc1 |
| InChI | InChI=1S/C24H39N3O3/c1-4-6-18-27(19-7-5-2)22-16-14-21(15-17-22)20-25-26-23(28)12-10-8-9-11-13-24(29)30-3/h14-17,20H,4-13,18-19H2,1-3H3,(H,26,28)/b25-20+ |
| InChIKey | JJIMBDNIMAZALI-LKUDQCMESA-N |
| XLogP | 5.06 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.59 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|